CymitQuimica logo

CAS 1019-60-9

:

4H-1-Benzopyran-4-one,2,3-dihydro-5-hydroxy-7-methoxy-2,2-dimethyl-

Description:
4H-1-Benzopyran-4-one, 2,3-dihydro-5-hydroxy-7-methoxy-2,2-dimethyl-, commonly known as a flavonoid compound, exhibits several notable characteristics. This substance is part of the larger class of compounds known as coumarins, which are characterized by their benzopyran structure. It typically appears as a crystalline solid and is soluble in organic solvents, with limited solubility in water. The presence of hydroxyl and methoxy groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmacological studies. Additionally, its structural features may influence its reactivity and interactions with other molecules, which can be significant in medicinal chemistry. The compound is often studied for its potential health benefits, including anti-inflammatory and antimicrobial activities. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a fascinating area of study within the field of natural products and their applications in health and medicine.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-12(2)6-9(14)11-8(13)4-7(15-3)5-10(11)16-12/h4-5,13H,6H2,1-3H3
InChI key:SBXQRIDZIXLNSM-UHFFFAOYSA-N
SMILES:CC1(CC(=O)C2=C(C=C(C=C2O1)OC)O)C
Found 3 products.