CymitQuimica logo

CAS 1019-71-2

:

Chlorodi(p-tolyl)phosphine

Description:
Chlorodi(p-tolyl)phosphine, with the CAS number 1019-71-2, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two p-tolyl groups and one chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the phosphorus-chlorine bond. It is a member of the phosphine family, which are known for their applications in organic synthesis and as ligands in coordination chemistry. Chlorodi(p-tolyl)phosphine can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal centers. Its properties, such as boiling point and solubility, can vary based on the specific conditions and the presence of other solvents or reagents. Safety precautions are essential when handling this compound, as it may pose risks associated with toxicity and reactivity. Overall, Chlorodi(p-tolyl)phosphine serves as a valuable intermediate in the synthesis of more complex organophosphorus compounds.
Formula:C14H14ClP
InChI:InChI=1/C14H14ClP/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3
InChI key:BJBXRRHIBSXGLF-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)P(c1ccc(C)cc1)Cl
Synonyms:
  • Bis(4-Methylphenyl)Phosphinous Chloride
Found 3 products.