CymitQuimica logo

CAS 101913-87-5

:

1,1,1,7,7,7-Hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)-4-heptan one dimethyl hydrazone

Description:
1,1,1,7,7,7-Hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)-4-heptanone dimethyl hydrazone is a complex organic compound characterized by its unique fluorinated structure. The presence of multiple trifluoromethyl groups contributes to its high lipophilicity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound features a hydrazone functional group, which can exhibit interesting reactivity and stability under certain conditions. Its hexafluoro and dihydroxy substituents enhance its chemical stability and may influence its solubility in different solvents. The compound's fluorinated nature often imparts unique physical properties, such as increased thermal stability and resistance to degradation. Additionally, the presence of hydroxyl groups can facilitate hydrogen bonding, potentially affecting its interaction with biological systems. Overall, this compound's distinctive characteristics make it a subject of interest for research and development in specialized applications, particularly where fluorinated compounds are advantageous.
Formula:C11H12F12N2O2
InChI:InChI=1/C11H12F12N2O2/c1-25(2)24-5(3-6(26,8(12,13)14)9(15,16)17)4-7(27,10(18,19)20)11(21,22)23/h26-27H,3-4H2,1-2H3
SMILES:CN(C)N=C(CC(C(F)(F)F)(C(F)(F)F)O)CC(C(F)(F)F)(C(F)(F)F)O
Synonyms:
  • 4-Heptanone, 2,6-bis(trifluoromethyl)-2,6-dihydroxy-1,1,1,7,7,7-hexafluoro-, dimethyl hydrazone
  • 1,1,1,7,7,7-Hexafluoro-2,6-dihydroxy-2,6-bis(trifluoromethyl)-4-heptanone dimethyl hydrazone
  • 2,6-Bis(trifluoromethyl)-2,6-dihydroxy-1,1,1,7,7,7-hexafluoro-4-heptanone dimethylhydrazone
  • 4-(Dimethylhydrazinylidene)-1,1,1,7,7,7-Hexafluoro-2,6-Bis(Trifluoromethyl)Heptane-2,6-Diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.