CAS 101990-69-6
:2,6-Dichloro-4-pyridinemethanol
Description:
2,6-Dichloro-4-pyridinemethanol is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with chlorine atoms and at the 4 position with a hydroxymethyl group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxymethyl group. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. Additionally, the compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 2,6-Dichloro-4-pyridinemethanol is a notable compound in organic chemistry with diverse potential applications.
Formula:C6H5Cl2NO
InChI:InChI=1S/C6H5Cl2NO/c7-5-1-4(3-10)2-6(8)9-5/h1-2,10H,3H2
InChI key:InChIKey=YDGJTFCKLFLWFM-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(Cl)N=C(Cl)C1
Synonyms:- (2,6-Dichloro-4-Pyridyl)Methanol
- (2,6-Dichloropyridin-4-Yl)Methanol
- 2,6-Dichloro-4-(hydroxymethyl)pyridine
- 2,6-Dichloro-4-Pyridinyl Methanol
- 2,6-Dichloro-4-pyridinemethanol
- 2,6-Dichloropyrid-4-ylcarbinol
- 2,6-Dichloropyridine-4-Methanol
- 2,6-Dichloropyridine-4-methanol ,98%
- 3,5-Bis(Methylsulphonyl)Aniline
- 4-Pyridinemethanol, 2,6-dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,6-Dichloro-4-pyridinemethanol
CAS:Formula:C6H5Cl2NOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:178.014-Pyridinemethanol, 2,6-dichloro-
CAS:Formula:C6H5Cl2NOPurity:98%Color and Shape:SolidMolecular weight:178.01602,6-Dichloropyridine-4-methanol
CAS:2,6-Dichloropyridine-4-methanolFormula:C6H5Cl2NOPurity:97%Molecular weight:178.022,6-Dichloro-4-(hydroxymethyl)pyridine
CAS:2,6-Dichloro-4-(hydroxymethyl)pyridineFormula:C6H5Cl2NOPurity:95%Color and Shape:Off-white SolidMolecular weight:178.0162,6-Dichloro-4-pyridinemethanol
CAS:Controlled ProductFormula:C6H5Cl2NOColor and Shape:NeatMolecular weight:178.022,6-Dichloropyridine-4-methanol
CAS:2,6-Dichloropyridine-4-methanol (2,6-DCPM) is a plant growth regulator that inhibits the production of chlorophyll and slows down photosynthesis. It has been shown to control plant diseases such as powdery mildew, rust, and black spot when applied as a foliar spray. 2,6-DCPM damages plants by interfering with the biosynthesis of benzoate and by reacting with chloride ions to form a residue that is toxic to plants. The trifluoromethyl group in 2,6-DCPM provides protection from degradation by hydrolysis or oxidation. This compound has been found to be effective against viruses such as tobacco mosaic virus and cucumber mosaic virus. 2,6-DCPM also controls crop pests such as aphids and leafhoppers.Formula:C6H5Cl2NOPurity:Min. 95%Molecular weight:178.02 g/mol






