CAS 102-38-5
:N-(3-Nitrophenyl)formamide
Description:
N-(3-Nitrophenyl)formamide, with the CAS number 102-38-5, is an organic compound characterized by its functional groups, including an amide and a nitro group. It features a formamide structure where the nitrogen atom is bonded to a 3-nitrophenyl group, which contributes to its chemical reactivity and properties. This compound typically appears as a solid at room temperature and is known for its pale yellow to light brown color. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. N-(3-Nitrophenyl)formamide is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its nitro group can participate in electrophilic aromatic substitution reactions, making it a valuable building block in synthetic chemistry. Additionally, safety precautions should be taken when handling this compound, as nitro-substituted compounds can be hazardous and may pose environmental risks.
Formula:C7H6N2O3
InChI:InChI=1S/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10)
InChI key:InChIKey=QCDUUALALDXTAD-UHFFFAOYSA-N
SMILES:N(C=O)C1=CC(N(=O)=O)=CC=C1
Synonyms:- Formamide, N-(3-nitrophenyl)-
- Formanilide, 3′-nitro-
- N-(3-nitrophenyl)formamide
- N-(m-Nitrophenyl)formamide
- m-Nitroformanilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Formamide, N-(3-nitrophenyl)-
CAS:Formula:C7H6N2O3Purity:97%Color and Shape:SolidMolecular weight:166.13413-Nitroformanilide
CAS:3-Nitroformanilide is an organic molecule that is synthesized by the reaction of formamide and nitroethane. It can be used as a precursor for the synthesis of other molecules with pharmaceutical properties, such as imines, sulfoxides, and nucleophilic anions. 3-Nitroformanilide has shown high reactivity with sulfoxide and nucleophilic anions in organic solvents. The reaction yield of the reaction between 3-nitroformanilide and sulfoxide increases when it is carried out in inorganic solvents. This reaction produces a nucleophilic anion, which can then be used to synthesize other molecules with pharmaceutical properties.
Formula:C7H6N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:166.13 g/mol



