CAS 102-93-2
:3-Phenylpropanamide
Description:
3-Phenylpropanamide, with the CAS number 102-93-2, is an organic compound characterized by its amide functional group attached to a propyl chain that is further substituted with a phenyl group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the phenyl group. The presence of the amide functional group contributes to its potential as a hydrogen bond donor and acceptor, influencing its reactivity and interactions in various chemical environments. 3-Phenylpropanamide can be synthesized through the reaction of phenylpropanol with an appropriate amine or through other synthetic pathways involving acylation reactions. It may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural characteristics allow it to participate in various chemical reactions, including acylation and amidation, which are relevant in organic synthesis and medicinal chemistry.
Formula:C9H11NO
InChI:InChI=1S/C9H11NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11)
InChI key:InChIKey=VYIBCOSBNVFEIW-UHFFFAOYSA-N
SMILES:C(CC(N)=O)C1=CC=CC=C1
Synonyms:- 2-Benzylacetamide
- 3-Phenylpropanamide
- 3-Phenylpropionamide
- Benzenepropanamide
- Benzylacetamide
- Gamma-Phenyl-Propionamide
- Hydrocinnamamide
- NSC 229316
- Phenylpropanamide
- β-Phenylpropionamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Phenylpropionamide
CAS:Formula:C9H11NOPurity:>98.0%(GC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:149.193-Phenylpropanamide
CAS:3-Phenylpropanamide is an aromatic compound widely used in biochemical experiments and drug synthesis research.Formula:C9H11NOColor and Shape:SolidMolecular weight:149.193-Phenyl-propionamide
CAS:3-Phenyl-propionamideFormula:C9H11NOPurity:98%Color and Shape:Solid-PowderMolecular weight:149.189743-Phenylpropionamide
CAS:3-Phenylpropionamide is a reactive compound that has been shown to have amine and amide functional groups. It is an inhibitor of the enzyme phospholipase A2, which is responsible for the release of arachidonic acid from membrane phospholipids. 3-Phenylpropionamide also blocks the interaction of κ subtype opioid receptors with their ligands and inhibits choroidal neovascularization in animal models. This drug has been shown to be toxic in animals, with adverse effects on metabolic disorders such as gamma-aminobutyric acid (GABA) levels.Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/mol





