CymitQuimica logo

CAS 1020038-42-9

:

IMidazo[1,2-a]pyridine-2-carboxylic acid, 7-chloro-

Description:
Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-chloro- is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group enhances its acidity and potential for hydrogen bonding, while the chloro substituent at the 7-position can influence its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often key components in drug design. Additionally, the presence of chlorine may enhance lipophilicity or alter the compound's interaction with biological targets. Overall, this compound's unique structural features make it of interest for further research in various chemical and biological contexts.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-5-1-2-11-4-6(8(12)13)10-7(11)3-5/h1-4H,(H,12,13)
InChI key:BEFUOITXMHRTRQ-UHFFFAOYSA-N
SMILES:C1=CN2C=C(N=C2C=C1Cl)C(=O)O
Found 3 products.