CAS 10201-73-7
:2-Amino-4-Methoxylpyridine
Description:
2-Amino-4-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) at the 2-position and a methoxy group (-OCH3) at the 4-position contributes to its unique chemical properties. This compound is typically a colorless to light yellow solid and is soluble in polar solvents such as water and alcohols due to the polar nature of its functional groups. It exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 2-Amino-4-methoxypyridine can be used in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its reactivity and functional groups make it a valuable intermediate in the development of more complex chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8)
Synonyms:- 4-Methoxypyridin-2-Amine
- 2-Amino-4-methoxy pyridine
- 2-Amino-4-methoxypyridine
- 4-Methoxy-2-aminopyridine
- 4-Methoxy-Pyridin-2-Ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Amino-4-methoxypyridine
CAS:Formula:C6H8N2OPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:124.142-Amino-4-methoxypyridine, 95%
CAS:2-Amino-4-methoxypyridine is a highly selective inducible nitric oxide synthase inhibitors. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar productFormula:C6H8N2OPurity:95%Molecular weight:124.142-Amino-4-methoxypyridine
CAS:2-Amino-4-methoxypyridineFormula:C6H8N2OPurity:≥95%Color and Shape:Solid-PowderMolecular weight:124.140522-Pyridinamine, 4-methoxy-
CAS:Formula:C6H8N2OPurity:98%Color and Shape:SolidMolecular weight:124.1405Ref: IN-DA0006BL
1kgTo inquire1g20.00€5g31.00€10g49.00€25g77.00€50g128.00€100g188.00€250g322.00€500g504.00€5kg2,543.00€2-Amino-4-methoxypyridine
CAS:2-Amino-4-methoxypyridineFormula:C6H8N2OPurity:98%Molecular weight:124.142-Amino-4-methoxypyridine
CAS:Controlled ProductApplications 2-Amino-4-methoxypyridine is a highly selective inducible nitric oxide synthase inhibitors.
References Connolly, S. et al.: J. Med. Chem., 47, 3320 (2004);Formula:C6H8N2OColor and Shape:NeatMolecular weight:124.14







