CymitQuimica logo

CAS 1020174-04-2

:

1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:
1-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is an organic compound characterized by its unique structure, which includes a pyrazole ring and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in boron chemistry, particularly in the context of organoboron compounds, which are valuable in various synthetic processes, including cross-coupling reactions. The compound's molecular structure indicates it may exhibit interesting reactivity due to the boron atom, which can participate in nucleophilic and electrophilic reactions. Additionally, the methyl group on the pyrazole ring can influence the compound's solubility and stability. This substance may also possess biological activity, making it of interest in medicinal chemistry. Overall, its characteristics suggest versatility in both synthetic and potential biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C10H17BN2O2
InChI:InChI=1S/C10H17BN2O2/c1-9(2)10(3,4)15-11(14-9)8-6-7-13(5)12-8/h6-7H,1-5H3
InChI key:BJMSXWLXFYZHIU-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C
Found 8 products.