CymitQuimica logo

CAS 1020252-22-5

:

2-[[(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]amino]benzonitrile

Description:
2-[[(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]amino]benzonitrile is a complex organic compound characterized by its unique structural features, which include a benzonitrile moiety and a dioxan derivative. The presence of the dioxan ring contributes to its potential reactivity and solubility properties, while the dimethyl groups enhance its steric bulk. This compound likely exhibits a range of chemical properties, including potential hydrogen bonding due to the amino group and the ability to participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its nitrile functional group may also impart specific electronic properties, influencing its reactivity and interactions with other molecules. The compound's molecular structure suggests it could be of interest in fields such as medicinal chemistry or materials science, where its unique characteristics might be leveraged for the development of new pharmaceuticals or functional materials. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H12N2O4
InChI:InChI=1S/C14H12N2O4/c1-14(2)19-12(17)10(13(18)20-14)8-16-11-6-4-3-5-9(11)7-15/h3-6,8,16H,1-2H3
InChI key:InChIKey=AMNDDWQGIGDDGU-UHFFFAOYSA-N
SMILES:C(NC1=C(C#N)C=CC=C1)=C2C(=O)OC(C)(C)OC2=O
Synonyms:
  • 2-[[(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]amino]benzonitrile
  • Benzonitrile, 2-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]amino]-
Found 4 products.