CymitQuimica logo

CAS 1020252-29-2

:

2-[[(2,5-Dimethoxyphenyl)amino]methylene]-1H-indene-1,3(2H)-dione

Description:
2-[[(2,5-Dimethoxyphenyl)amino]methylene]-1H-indene-1,3(2H)-dione, identified by its CAS number 1020252-29-2, is a synthetic organic compound characterized by its complex molecular structure, which includes an indene-1,3-dione core substituted with a dimethoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of methoxy groups enhances its solubility and reactivity, while the indene structure may impart unique electronic properties. It may be of interest in medicinal chemistry due to its potential as a pharmacophore, possibly influencing various biological pathways. The compound's stability, reactivity, and interactions with biological targets can be influenced by factors such as pH, solvent, and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any risks associated with exposure or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C18H15NO4
InChI:InChI=1S/C18H15NO4/c1-22-11-7-8-16(23-2)15(9-11)19-10-14-17(20)12-5-3-4-6-13(12)18(14)21/h3-10,19H,1-2H3
InChI key:InChIKey=XFZVPYBIMALUPE-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C1=CNC3=C(OC)C=CC(OC)=C3)=CC=CC2
Synonyms:
  • 1H-Indene-1,3(2H)-dione, 2-[[(2,5-dimethoxyphenyl)amino]methylene]-
  • 2-[[(2,5-Dimethoxyphenyl)amino]methylene]-1H-indene-1,3(2H)-dione
Found 1 products.