CymitQuimica logo

CAS 1020253-85-3

:

3-Pyridinamine, 6-bromo-5-methoxy-

Description:
3-Pyridinamine, 6-bromo-5-methoxy- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position and a methoxy group (-OCH3) at the 5-position contributes to its unique chemical properties and reactivity. This compound is likely to exhibit moderate polarity due to the electronegative nitrogen and bromine atoms, influencing its solubility in various solvents. The methoxy group can participate in hydrogen bonding, enhancing its interaction with polar solvents. Additionally, the amino group (-NH2) at the 3-position can act as a nucleophile, making the compound potentially useful in various chemical reactions, including substitution and coupling reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as many pyridine derivatives are known for their biological activity. However, specific biological properties and applications would require further investigation and characterization.
Formula:C6H7BrN2O
InChI:InChI=1S/C6H7BrN2O/c1-10-5-2-4(8)3-9-6(5)7/h2-3H,8H2,1H3
InChI key:InChIKey=VNJYEDKEMNOYBM-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)N=CC(N)=C1
Synonyms:
  • 6-Bromo-5-methoxypyridin-3-amine
  • 3-Pyridinamine, 6-bromo-5-methoxy-
Found 4 products.