CymitQuimica logo

CAS 102045-96-5

:

(S)-2,2-Dimethyl-1,3-dioxolane-4-carboxylic acid

Description:
(S)-2,2-Dimethyl-1,3-dioxolane-4-carboxylic acid is a chiral compound characterized by its unique dioxolane ring structure, which contributes to its stability and reactivity. This compound features a carboxylic acid functional group, making it acidic in nature, and the presence of two methyl groups at the 2-position enhances its steric bulk. The stereochemistry indicated by the (S) designation suggests that it has specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. This compound is typically soluble in polar solvents due to the presence of the carboxylic acid group, and it may participate in various chemical reactions, including esterification and amidation. Its applications may extend to fields such as pharmaceuticals, where it could serve as an intermediate in the synthesis of biologically active compounds. Overall, the characteristics of (S)-2,2-Dimethyl-1,3-dioxolane-4-carboxylic acid make it a compound of interest in both synthetic and medicinal chemistry.
Formula:C6H10O4
InChI:InChI=1/C6H10O4/c1-6(2)9-3-4(10-6)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4-/m0/s1
InChI key:OZPFVBLDYBXHAF-BYPYZUCNSA-N
SMILES:CC1(C)OC[C@@H](C(=O)O)O1
Synonyms:
  • 1,3-Dioxolane-4-carboxylicacid,2,2-dimethyl-,(4S)-(9CI)
  • (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid
Found 2 products.