CAS 102056-97-3
:N-TRITYL-L-HOMOSERINE TRIETHYLAMINE SALT
Description:
N-Trityl-L-homoserine triethylamine salt is a chemical compound characterized by its unique structure, which includes a trityl group attached to the amino acid homoserine. This compound typically exhibits properties associated with both amino acids and quaternary ammonium salts due to the presence of the triethylamine moiety. It is often utilized in organic synthesis and peptide chemistry, serving as a protecting group for amino acids during various reactions. The trityl group provides stability and protection against unwanted reactions, while the triethylamine salt form enhances solubility in organic solvents. This compound is generally stable under standard laboratory conditions but may require specific handling to avoid degradation or hydrolysis. Its applications can extend to biochemical research, particularly in the synthesis of peptides and other complex organic molecules. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment and adherence to material safety data sheet (MSDS) guidelines.
Formula:C23H23N1O3
InChI:InChI=1S/C23H23NO3.C6H15N/c25-17-16-21(22(26)27)24-23(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-4-7(5-2)6-3/h1-15,21,24-25H,16-17H2,(H,26,27);4-6H2,1-3H3/t21-;/m0./s1
InChI key:LRIHVFUNJCWVBP-BOXHHOBZSA-N
SMILES:CCN(CC)CC.C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@@H](CCO)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
L-Homoserine, N-(triphenylmethyl)-, compd. with N,N-diethylethanamine (1:1)
CAS:Formula:C29H38N2O3Molecular weight:462.6236

