CymitQuimica logo

CAS 102066-01-3

:

2-(2-bromo-4-methylphenoxy)acetamide

Description:
2-(2-bromo-4-methylphenoxy)acetamide is an organic compound characterized by its amide functional group and a phenoxy moiety. It features a bromine atom and a methyl group on the aromatic ring, which contribute to its chemical reactivity and physical properties. The presence of the bromine substituent typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The acetamide group provides solubility in polar solvents and can participate in hydrogen bonding, influencing its interactions in biological systems. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its molecular structure suggests it could be involved in various applications, including agrochemicals or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 2-(2-bromo-4-methylphenoxy)acetamide is a versatile compound with potential applications in both research and industry.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c1-6-2-3-8(7(10)4-6)13-5-9(11)12/h2-4H,5H2,1H3,(H2,11,12)
InChI key:CKBRNCLZMLTJDM-UHFFFAOYSA-N
SMILES:Cc1ccc(c(c1)Br)OCC(=N)O
Synonyms:
  • Acetamide, 2-(2-Bromo-4-Methylphenoxy)-
Found 2 products.