CAS 1020719-48-5
:1,3-Dihydro-1-(methyl-d3)-6-phenyl-2H-imidazo[4,5-b]pyridin-2-one
Description:
1,3-Dihydro-1-(methyl-d3)-6-phenyl-2H-imidazo[4,5-b]pyridin-2-one is a chemical compound characterized by its unique imidazopyridinone structure, which features a fused imidazole and pyridine ring system. This compound contains a phenyl group and a deuterated methyl group, indicated by the "methyl-d3" designation, suggesting the presence of three deuterium atoms in the methyl group. The presence of these isotopes can influence the compound's physical and chemical properties, such as its stability and reactivity. Typically, imidazopyridinones exhibit biological activity, making them of interest in medicinal chemistry for potential therapeutic applications. The compound's molecular structure contributes to its potential interactions with biological targets, and its solubility, melting point, and other physical properties would be influenced by the specific functional groups and their arrangement. Overall, this compound represents a class of heterocyclic compounds that are often explored for their pharmacological properties.
Formula:C13H11N3O
InChI:InChI=1S/C13H11N3O/c1-16-11-7-10(9-5-3-2-4-6-9)8-14-12(11)15-13(16)17/h2-8H,1H3,(H,14,15,17)/i1D3
InChI key:InChIKey=PDYMCBRGMDRAPX-FIBGUPNXSA-N
SMILES:C(N1C=2C(NC1=O)=NC=C(C2)C3=CC=CC=C3)([2H])([2H])[2H]
Synonyms:- 1,3-Dihydro-1-(methyl-d3)-6-phenyl-2H-imidazo[4,5-b]pyridin-2-one
- 2H-Imidazo[4,5-b]pyridin-2-one, 1,3-dihydro-1-(methyl-d3)-6-phenyl-
- 2-Hydroxy-1-methyl-6-phenylimidazo(4,5-b)pyridine-d3
- 1,3-Dihydro-1-Methyl-6-phenyl-2H-iMidazo[4,5-b]pyridin-2-one-d3
- 2-Hydroxy-1-(methyl-d3)-6-phenylimidazo(4,5-b)pyridine
- 6-phenyl-1-(trideuteriomethyl)-3H-imidazo[4,5-b]pyridin-2-one
- 1,3-Dihydro-1-(methyl-d
- 3
- )-6-phenyl-2H-imidazo[4,5-b]pyridin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxy-1-methyl-6-phenylimidazo(4,5-b)pyridine-d3
CAS:Controlled ProductStability Light Sensitive
Applications 2-Hydroxy-1-methyl-6-phenylimidazo(4,5-b)pyridine-d3 (cas# 1020719-48-5) is a compound useful in organic synthesis.Formula:C132H3H8N3OColor and Shape:NeatMolecular weight:228.26
