CAS 1020719-56-5
:2,3′-Bipyridine-3,4,5,6-d4
Description:
2,3′-Bipyridine-3,4,5,6-d4 is a deuterated derivative of bipyridine, a compound consisting of two pyridine rings connected by a carbon-carbon bond. The deuteration indicates that hydrogen atoms in specific positions of the bipyridine structure have been replaced with deuterium, a heavier isotope of hydrogen. This modification can significantly influence the compound's physical and chemical properties, such as its solubility, reactivity, and spectroscopic characteristics. 2,3′-Bipyridine is often utilized in coordination chemistry and catalysis due to its ability to chelate metal ions. The presence of deuterium can enhance the study of reaction mechanisms and dynamics through techniques like NMR spectroscopy, as deuterium has distinct magnetic properties compared to hydrogen. The compound is typically used in research settings, particularly in studies involving isotopic labeling and the development of new materials or catalysts. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C10H4D4N2
InChI:InChI=1S/C10H8N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-8H/i1D,2D,5D,7D
InChI key:InChIKey=VEKIYFGCEAJDDT-FFLOCCJLSA-N
SMILES:C=1(C=CC=NC1)C2=C(C(=C(C(=N2)[2H])[2H])[2H])[2H]
Synonyms:- 2,3′-Bipyridine-3,4,5,6-d4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isonicoteine-3,4,5,6-d4
CAS:Controlled ProductApplications Isonicoteine-3,4,5,6-d4 (cas# 1020719-56-5) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C10H4D4N2Color and Shape:NeatMolecular weight:160.21
