CAS 1020719-60-1
:3-Methoxy-2-(methyl-d3)-N-phenylbenzamide
Description:
3-Methoxy-2-(methyl-d3)-N-phenylbenzamide, identified by its CAS number 1020719-60-1, is a chemical compound that belongs to the class of benzamides. This substance features a methoxy group (-OCH3) and a phenyl group attached to a benzamide structure, which contributes to its potential applications in medicinal chemistry and research. The presence of the deuterated methyl group (methyl-d3) indicates that three hydrogen atoms in the methyl group are replaced by deuterium, which can be useful in studies involving isotopic labeling. The compound is likely to exhibit characteristics typical of aromatic amides, such as moderate solubility in organic solvents and potential interactions with biological targets due to its aromatic nature. Its molecular structure suggests that it may participate in hydrogen bonding and π-π stacking interactions, which are important in biological systems. Overall, 3-Methoxy-2-(methyl-d3)-N-phenylbenzamide is of interest for its unique isotopic composition and potential applications in drug development and chemical research.
Formula:C15H12D3NO2
InChI:InChI=1S/C15H15NO2/c1-11-13(9-6-10-14(11)18-2)15(17)16-12-7-4-3-5-8-12/h3-10H,1-2H3,(H,16,17)/i1D3
InChI key:InChIKey=JMYLVZGGEKBZAB-FIBGUPNXSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=C(C([2H])([2H])[2H])C(OC)=CC=C2
Synonyms:- 3-Methoxy-2-(methyl-d3)-N-phenylbenzamide
- Benzamide, 3-methoxy-2-(methyl-d3)-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methoxy-2-methyl-N-phenylbenzamide-d3
CAS:Controlled ProductFormula:C152H3H12NO2Color and Shape:NeatMolecular weight:244.3
