CAS 1020719-96-3
:3a,4,7,7a-Tetrahydro-4,7-d2-1H-isoindole-1,3(2H)-dione-4,5,6,7-d4
Description:
3a,4,7,7a-Tetrahydro-4,7-d2-1H-isoindole-1,3(2H)-dione-4,5,6,7-d4 is a synthetic organic compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered and a six-membered ring. This compound is notable for its deuterated forms, indicated by the presence of deuterium (d) at specific positions, which can influence its physical and chemical properties, such as stability, reactivity, and isotopic labeling in research applications. The presence of multiple deuterium atoms suggests potential uses in studies involving metabolic pathways or tracer studies in organic chemistry. Its molecular structure includes carbonyl groups, contributing to its reactivity and potential applications in medicinal chemistry. The compound's unique isotopic composition may also enhance its analytical detection in various spectroscopic techniques. Overall, this compound represents a specialized class of isoindole derivatives with potential implications in both synthetic and applied chemistry.
Formula:C8H3D6NO2
InChI:InChI=1S/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-2,5-6H,3-4H2,(H,9,10,11)/i1D,2D,3D2,4D2
InChI key:InChIKey=CIFFBTOJCKSRJY-TZCZJOIZSA-N
SMILES:O=C1C2C(C(=O)N1)C(C(=C(C2([2H])[2H])[2H])[2H])([2H])[2H]
Synonyms:- 3a,4,7,7a-Tetrahydro-4,7-d2-1H-isoindole-1,3(2H)-dione-4,5,6,7-d4
- 1H-Isoindole-1,3(2H)-dione-4,5,6,7-d4, 3a,4,7,7a-tetrahydro-4,7-d2-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3,6-Tetrahydrophthalimide-3,3,4,5,6,6-d6
CAS:Controlled ProductApplications 1,2,3,6-Tetrahydrophthalimide-3,3,4,5,6,6-d6 (cas# 1020719-96-3) is a compound useful in organic synthesis.
Formula:C82H6H3NO2Color and Shape:NeatMolecular weight:157.2
