
CAS 102072-82-2
:6,7-Dichloro-5,8-quinoxalinedione
Description:
6,7-Dichloro-5,8-quinoxalinedione, with the CAS number 102072-82-2, is a synthetic organic compound characterized by its unique bicyclic structure, which features a quinoxaline core with two chlorine substituents at the 6 and 7 positions and a diketone functionality at the 5 and 8 positions. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. Its chlorinated structure may impart specific electronic properties, making it of interest in the development of dyes or as a precursor in organic synthesis. The presence of the diketone groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 6,7-Dichloro-5,8-quinoxalinedione is a compound of interest due to its structural features and potential reactivity.
Formula:C8H2Cl2N2O2
InChI:InChI=1S/C8H2Cl2N2O2/c9-3-4(10)8(14)6-5(7(3)13)11-1-2-12-6/h1-2H
InChI key:InChIKey=SEYCJGXCYDOTGT-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C(Cl)=C1Cl)=NC=CN2
Synonyms:- 5,8-Quinoxalinedione, 6,7-dichloro-
- 6,7-Dichloro-5,8-quinoxalinedione
- 6,7-Dichloroquinoxaline-5,8-dione
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6,7-Dichloroquinoxaline-5,8-dione
CAS:6,7-Dichloroquinoxaline-5,8-dione is an anti-cancer drug that has been found to be a potent inhibitor of DNA topoisomerase I. This drug is highly active against lung adenocarcinoma cells and tumour cell lines. It also exhibits trackability in vivo and in vitro, which makes it a good candidate for use as a molecular imaging agent. 6,7-Dichloroquinoxaline-5,8-dione has been shown to be effective against various types of tumours in animal models and human cell lines. 6,7-Dichloroquinoxaline-5,8-dione also inhibits the growth of tumour cells by arresting the cell cycle at G2/M phase and inducing apoptosis through caspase activation.
Formula:C8H2Cl2N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:229.02 g/mol

