
CAS 10208-80-7
:alpha-Muurolene
Description:
Alpha-Muurolene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various essential oils, particularly those derived from plants like the Muurolaceae family. It is characterized by its distinct bicyclic structure, which contributes to its unique physical and chemical properties. Alpha-Muurolene is typically a colorless to pale yellow liquid with a characteristic odor, making it valuable in the fragrance and flavor industries. Its molecular formula is C15H24, and it has a relatively low boiling point, which is common for many terpenes. The compound exhibits hydrophobic properties, making it insoluble in water but soluble in organic solvents. Additionally, alpha-Muurolene has been studied for its potential biological activities, including antimicrobial and anti-inflammatory effects, although further research is needed to fully understand its pharmacological properties. Its presence in essential oils also suggests potential applications in aromatherapy and natural product formulations. Overall, alpha-Muurolene is an interesting compound with diverse applications in both industrial and therapeutic contexts.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,9-10,13-15H,5,7-8H2,1-4H3/t13-,14+,15-/m0/s1
InChI key:InChIKey=QMAYBMKBYCGXDH-ZNMIVQPWSA-N
SMILES:[C@@H](C)(C)[C@H]1[C@]2([C@@](C(C)=CC1)(CCC(C)=C2)[H])[H]
Synonyms:- 1β-Cadina-4,9-diene
- α-Muurolene
- (1S,4aS,8aR)-1,2,4a,5,6,8a-Hexahydro-4,7-dimethyl-1-(1-methylethyl)naphthalene
- Naphthalene, 1,2,4a,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, (1S,4aS,8aR)-
- Naphthalene, 1,2,4a,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)-, [1S-(1α,4aα,8aα)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
