CAS 102082-89-3
:trans-2,6-Difluorocinnamic acid
Description:
Trans-2,6-Difluorocinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone with two fluorine substituents at the 2 and 6 positions of the aromatic ring. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and materials science due to its interesting electronic and steric properties. The presence of fluorine atoms can enhance lipophilicity and influence the compound's reactivity and stability. Trans-2,6-Difluorocinnamic acid exhibits typical characteristics of carboxylic acids, including the ability to form hydrogen bonds, which can affect its solubility in various solvents. Its trans configuration contributes to its geometric stability and may influence its interactions with biological targets. As with many fluorinated compounds, it may exhibit unique behavior in terms of reactivity and biological activity, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C9H5F2O2
InChI:InChI=1/C9H6F2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+
Synonyms:- (2E)-3-(2,6-Difluorophenyl)-2-propenoic acid
- Rarechem Bk Hw 0116
- Timtec-Bb Sbb006676
- trans-2,6-Difluorocinnamicacid
- 3-(2,6-Difluoro-Phenyl)-Acrylic Acid
- 2,6-Difluorocinnamic acid
- 1,1'-(1,1,1,3,3,3-Hexafluoropropane-2,2-Diyl)Bis(4-Isocyanatobenzene)
- (2E)-3-(2,6-difluorophenyl)prop-2-enoic acid
- (2E)-3-(2,6-difluorophenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans-2,6-Difluorocinnamic Acid
CAS:Formula:C9H6F2O2Purity:>95.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:184.14(E)-3-(2,6-Difluorophenyl)acrylic acid
CAS:(E)-3-(2,6-Difluorophenyl)acrylic acidFormula:C9H6F2O2Purity:98%Molecular weight:184.14trans-2,6-Difluorocinnamic acid
CAS:trans-2,6-Difluorocinnamic acidFormula:C9H6F2O2Purity:98%Color and Shape:Solid-PowderMolecular weight:184.139542-Propenoic acid, 3-(2,6-difluorophenyl)-, (2E)-
CAS:Formula:C9H6F2O2Purity:98%Color and Shape:SolidMolecular weight:184.1395trans-2,6-Difluorocinnamic acid
CAS:Formula:C9H6F2O2Purity:98%Color and Shape:SolidMolecular weight:184.142




