CymitQuimica logo

CAS 10212-31-4

:

2-Amino-1-β-<span class="text-smallcaps">D</span>-arabinofuranosyl-5-methyl-4(1H)-pyrimidinone

Description:
2-Amino-1-β-D-arabinofuranosyl-5-methyl-4(1H)-pyrimidinone, with CAS number 10212-31-4, is a nucleoside analog that exhibits structural similarities to naturally occurring nucleosides. This compound features a β-D-arabinofuranosyl sugar moiety, which contributes to its biological activity. The presence of the amino group at the 2-position and the methyl group at the 5-position of the pyrimidine ring are significant for its interaction with biological targets, particularly in nucleic acid synthesis and metabolism. This compound has garnered interest in medicinal chemistry due to its potential antiviral and anticancer properties, as it may interfere with nucleic acid synthesis in pathogens or cancer cells. Its solubility and stability in biological systems are important characteristics that influence its pharmacokinetics and therapeutic efficacy. Additionally, the compound's ability to mimic natural nucleosides allows it to be incorporated into RNA or DNA, potentially disrupting normal cellular functions. Overall, 2-Amino-1-β-D-arabinofuranosyl-5-methyl-4(1H)-pyrimidinone represents a valuable compound in the exploration of new therapeutic agents.
Formula:C10H15N3O5
InChI:InChI=1S/C10H15N3O5/c1-4-2-13(10(11)12-8(4)17)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7+,9-/m1/s1
InChI key:InChIKey=JUFWRFOUTDSMSO-JAGXHNFQSA-N
SMILES:O[C@@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(N)=NC(=O)C(C)=C2
Synonyms:
  • 2-Amino-1-β-D-arabinofuranosyl-5-methyl-4(1H)-pyrimidinone
  • 4(1H)-Pyrimidinone, 2-amino-1-β-D-arabinofuranosyl-5-methyl-
Found 1 products.