CymitQuimica logo

CAS 102123-28-4

:

methyl 3-amino-4-cyanothiophene-2-carboxylate

Description:
Methyl 3-amino-4-cyanothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring, an amino group, and a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of electron-withdrawing groups like the cyano and carboxylate functionalities. The amino group can participate in hydrogen bonding, influencing its solubility and reactivity in various solvents. Methyl 3-amino-4-cyanothiophene-2-carboxylate is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its potential applications are linked to its ability to undergo various chemical transformations, including nucleophilic substitutions and coupling reactions. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C7H6N2O2S
InChI:InChI=1/C7H6N2O2S/c1-11-7(10)6-5(9)4(2-8)3-12-6/h3H,9H2,1H3
InChI key:AEWVEROSMGRHRG-UHFFFAOYSA-N
SMILES:COC(=O)c1c(c(C#N)cs1)N
Found 4 products.