CAS 102127-34-4

4-Bromo-3-methoxyphenol

Description:

4-Bromo-3-methoxyphenol, with the CAS number 102127-34-4, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a phenolic structure. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties due to the phenolic ring. The bromine substituent enhances its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The methoxy group contributes to its solubility in organic solvents and can influence its biological activity. 4-Bromo-3-methoxyphenol may exhibit antioxidant properties and has potential applications in research related to medicinal chemistry. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, making it important to consider these factors in practical applications.

Formula: C₇H₇BrO₂

InChI: InChI=1/C7H7BrO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,1H3

SMILES: COc1cc(ccc1Br)O

Synonyms:

• 3-Methoxy-4-Bromophenol
• 4-Bromo-5-methoxyphenol
• 4-Bromo-3-methoxy-phenol

4-Bromo-3-methoxyphenol

CAS: 102127-34-4

4-Bromo-3-methoxyphenol

Formula: C₇H₇BrO₂

Purity: 98%

Color and Shape: White Solid-Powder

Molecular weight: 203.03328

Ref: 54-OR30937

Phenol, 4-bromo-3-methoxy-

CAS: 102127-34-4

Formula: C₇H₇BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 203.0333

Ref: IN-DA0006PF

4-Bromo-3-methoxyphenol

CAS: 102127-34-4

Formula: C₇H₇BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 203.035

Ref: 10-F037017