CymitQuimica logo

CAS 1021298-67-8

:

Piperazine, 1-(cyclopropylcarbonyl)-, monohydrochloride

Description:
Piperazine, 1-(cyclopropylcarbonyl)-, monohydrochloride is a chemical compound that belongs to the piperazine class, which is characterized by a six-membered ring containing two nitrogen atoms. This specific derivative features a cyclopropylcarbonyl group, which contributes to its unique properties and potential biological activity. The monohydrochloride form indicates that the compound is a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. Piperazine derivatives are often studied for their pharmacological properties, including their potential as anxiolytics, antidepressants, or antipsychotics. The presence of the cyclopropyl group may influence the compound's interaction with biological targets, potentially affecting its efficacy and safety profile. As with many piperazine derivatives, understanding its structure-activity relationship is crucial for exploring its therapeutic potential. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C8H15ClN2O
InChI:InChI=1S/C8H14N2O.ClH/c11-8(7-1-2-7)10-5-3-9-4-6-10;/h7,9H,1-6H2;1H
InChI key:WIHDAPMHNYYTOA-UHFFFAOYSA-N
SMILES:C1CC1C(=O)N2CCNCC2.Cl
Synonyms:
  • N-(Cyclopropylcarbonyl)piperazine hydrochloride
  • 1-(Cyclopropylcarbonyl)piperazine hydrochloride
  • (Cyclopropyl)(piperazin-1-yl)methanone hydrochloride
Found 7 products.