CAS 102146-07-6: DPCPX
Description:DPCPX, or 1,3-Dipropyl-8-cyclopentylxanthine, is a selective antagonist of the adenosine A1 receptor, which plays a crucial role in various physiological processes, including neurotransmission and cardiovascular function. This compound is characterized by its xanthine structure, which is modified with propyl and cyclopentyl groups, enhancing its selectivity and potency for the A1 receptor. DPCPX is typically used in pharmacological research to study the effects of adenosine receptor modulation on various biological systems. It is known for its ability to inhibit the actions of adenosine, thereby influencing processes such as heart rate and neurotransmitter release. The compound is often utilized in experimental settings to explore potential therapeutic applications, particularly in conditions where adenosine signaling is implicated, such as ischemia or neurodegenerative diseases. DPCPX is usually handled with care in laboratory environments, adhering to safety protocols due to its biological activity.
Formula:C16H24N4O2
InChI:InChI=1S/C16H24N4O2/c1-3-9-19-14-12(15(21)20(10-4-2)16(19)22)17-13(18-14)11-7-5-6-8-11/h11H,3-10H2,1-2H3,(H,17,18)
InChI key:InChIKey=FFBDFADSZUINTG-UHFFFAOYSA-N
SMILES:O=C1C=2NC(=NC2N(C(=O)N1CCC)CCC)C3CCCC3
- Synonyms:
- 1,3-Dipropyl-8-cyclopentylxanthine
- 1,3-Dpcpx
- 1H-Purine-2,6-dione, 8-cyclopentyl-3,7-dihydro-1,3-dipropyl-
- 1H-Purine-2,6-dione, 8-cyclopentyl-3,9-dihydro-1,3-dipropyl-
- 8-Cyclopentyl-3,7-dihydro-1,3-dipropyl-1H-purin-2,6-dione
- 8-Cyclopentyl-3,9-dihydro-1,3-dipropyl-1H-purine-2,6-dione
- 8-cyclopentyl-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione
- Dpcpx
- Pd 116948
- 8-Cyclopentyl-1,3-dipropylxanthine
- See more synonyms
- 8-Cyclopentyl-1,3-dipropylxanthine
