CymitQuimica logo

CAS 10215-75-5

:

Cortisone 21-hemisuccinate

Description:
Cortisone 21-hemisuccinate is a synthetic derivative of cortisone, a steroid hormone that plays a crucial role in various physiological processes, including metabolism and immune response regulation. This compound is characterized by the addition of a hemisuccinate group at the 21-position of the cortisone molecule, which enhances its solubility and bioavailability. Cortisone 21-hemisuccinate exhibits anti-inflammatory and immunosuppressive properties, making it useful in medical applications, particularly in the treatment of conditions such as allergies, autoimmune disorders, and certain types of inflammation. The compound is typically administered in a pharmaceutical formulation, often as an injectable or topical preparation. Its pharmacokinetics involve metabolism primarily in the liver, leading to the formation of active metabolites. As with other corticosteroids, potential side effects may include increased susceptibility to infections, fluid retention, and alterations in glucose metabolism. Overall, Cortisone 21-hemisuccinate serves as an important therapeutic agent in clinical settings, leveraging its steroidal structure to modulate biological responses effectively.
Formula:C25H32O8
InChI:InChI=1S/C25H32O8/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30/h11,16-17,22,32H,3-10,12-13H2,1-2H3,(H,29,30)/t16-,17-,22+,23-,24-,25-/m0/s1
InChI key:WVSVAJGDZIWYBX-WFLBVZAHSA-N
SMILES:C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@]4(C(=O)COC(=O)CCC(=O)O)O)C
Synonyms:
  • 4-(2-((8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethoxy)-4-oxobutanoic acid
  • Pregn-4-ene-3,11,20-trione, 21-(3-carboxy-1-oxopropoxy)-17-hydroxy-
  • Cortisone 21-succinate
Found 2 products.