CAS 102151-33-7
:3-Chloro-4-methoxybenzonitrile
Description:
3-Chloro-4-methoxybenzonitrile, with the CAS number 102151-33-7, is an organic compound characterized by its aromatic structure, which includes a chloro group and a methoxy group attached to a benzonitrile framework. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the chloro substituent contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. The methoxy group enhances its electron-donating properties, influencing its reactivity and interaction with other chemical species. Additionally, 3-Chloro-4-methoxybenzonitrile may exhibit biological activity, which can be explored in medicinal chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate risks associated with its use.
Formula:C8H6ClNO
InChI:InChI=1/C8H6ClNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3
SMILES:COc1ccc(cc1Cl)C#N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzonitrile, 3-chloro-4-methoxy-
CAS:Formula:C8H6ClNOPurity:95%Color and Shape:SolidMolecular weight:167.59233-Chloro-4-methoxybenzonitrile
CAS:3-Chloro-4-methoxybenzonitrileFormula:C8H6ClNOPurity:98%Molecular weight:167.593-Chloro-4-methoxybenzonitrile
CAS:3-Chloro-4-methoxybenzonitrile is a chemical compound that can be used as a reactant, reagent, or building block in the synthesis of other chemicals. It is an important intermediate for the production of pharmaceuticals, pesticides and dyes. 3-Chloro-4-methoxybenzonitrile is also being investigated for use in the manufacture of photoresists for semiconductor device fabrication. This chemical is listed on the Chemical Abstracts Service registry with CAS number 102151-33-7.
Formula:C8H6ClNOPurity:Min. 95%Color and Shape:SolidMolecular weight:167.59 g/mol3-Chloro-4-methoxybenzonitrile
CAS:3-Chloro-4-methoxybenzonitrileFormula:C8H6ClNOPurity:98%Molecular weight:167.593-Chloro-4-methoxybenzonitrile
CAS:Formula:C8H6ClNOPurity:95%Color and Shape:SolidMolecular weight:167.59




