CAS 102169-71-1

5-Formyl-furan-3-carbonsaeure-methylester

Description:

5-Formyl-furan-3-carboxylic acid methyl ester, identified by the CAS number 102169-71-1, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a formyl group (-CHO) at the 5-position and a methyl ester group (-COOCH3) at the 3-position of the furan ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and oxidation, making it a versatile intermediate in organic synthesis. Additionally, the methyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit biological activity, and its derivatives could be explored for potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, proper handling and safety precautions are essential due to potential reactivity and toxicity.

Formula: C7H6O4

InChI: InChI=1S/C7H6O4/c1-10-7(9)5-2-6(3-8)11-4-5/h2-4H,1H3

InChI key: RKSNUGDDGDFSRP-UHFFFAOYSA-N

SMILES: COC(=O)C1=COC(=C1)C=O

3-Furancarboxylic acid, 5-forMyl-, Methyl ester

CAS: 102169-71-1

Formula: C₇H₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.1201

Ref: IN-DA009S4C

Methyl 5-formylfuran-3-carboxylate

CAS: 102169-71-1

Methyl 5-formylfuran-3-carboxylate

Formula: C₇H₆O₄

Purity: 98%

Molecular weight: 154.12

Ref: 54-OR84148

Methyl 5-formylfuran-3-carboxylate

CAS: 102169-71-1

Methyl 5-formylfuran-3-carboxylate

Formula: C₇H₆O₄

Purity: 97%

Molecular weight: 154.12

Ref: IN-DG682992

Methyl 5-formylfuran-3-carboxylate

CAS: 102169-71-1

Purity: 98%

Molecular weight: 154.1210022

Ref: 10-F780704

Methyl 5-formylfuran-3-carboxylate

CAS: 102169-71-1

Methyl 5-formylfuran-3-carboxylate is a synthetic t-cell leukemia agent that has been shown to have cytotoxic effects on carcinoma cells. This compound is an isomer of methyl 5-formylhydroquinone and has been shown to inhibit the growth of staphylococcus, faecalis, and other bacteria. Methyl 5-formylfuran-3-carboxylate also inhibits the growth of various cancer cells in vitro and in vivo. The mechanism of action for this compound relies on its ability to inhibit cellular respiration by inhibiting mitochondrial ATP synthase. Methyl 5-formylfuran-3-carboxylate can be used as a cytotoxic agent against a number of cancers including those that are resistant to other chemotherapeutic agents.

Formula: C₇H₆O₄

Purity: Min. 95%

Molecular weight: 154.12 g/mol

Ref: 3D-CEA16971