CAS 102169-99-3

2-Bromo-4-methyl-5-nitrobenzenamine

Description:

2-Bromo-4-methyl-5-nitrobenzenamine, with the CAS number 102169-99-3, is an organic compound that belongs to the class of aromatic amines. It features a bromine atom, a methyl group, and a nitro group attached to a benzene ring, which contributes to its unique chemical properties. The presence of the amino group (-NH2) makes it a primary amine, allowing for potential reactivity in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The nitro group (-NO2) is a strong electron-withdrawing group, which can influence the compound's reactivity and stability. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents. Its bromine substituent can also impart specific reactivity, making it useful in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as many aromatic amines can be hazardous and potentially carcinogenic. Overall, 2-Bromo-4-methyl-5-nitrobenzenamine is of interest in various fields, including pharmaceuticals and materials science.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1S/C7H7BrN2O2/c1-4-2-5(8)6(9)3-7(4)10(11)12/h2-3H,9H2,1H3

InChI key: InChIKey=MZYLMACPWDPBQN-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C)C=C(Br)C(N)=C1

Synonyms:

• 2-Bromo-4-methyl-5-nitrobenzenamine
• Benzenamine, 2-bromo-4-methyl-5-nitro-
• 2-Bromo-4-methyl-5-nitroaniline
• p-Toluidine, 2-bromo-5-nitro-

Benzenamine, 2-bromo-4-methyl-5-nitro-

CAS: 102169-99-3

Formula: C₇H₇BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.0467

Ref: IN-DA0006SG

2-Bromo-4-methyl-5-nitroaniline

CAS: 102169-99-3

2-Bromo-4-methyl-5-nitroaniline

Purity: 98%

Molecular weight: 231.05g/mol

Ref: 54-OR480479

2-Bromo-4-methyl-5-nitroaniline

CAS: 102169-99-3

Formula: C₇H₇BrN₂O₂

Purity: 95%

Molecular weight: 231.049

Ref: 10-F231700

2-Bromo-4-methyl-5-nitroaniline

CAS: 102169-99-3

2-Bromo-4-methyl-5-nitroaniline is a chemical intermediate that is used in the production of various 2,4,5-trichlorophenol derivatives. It can be synthesized by the reaction of methylbenzene with nitrous acid and sodium nitrite. The product has a melting point of 170°C and is stable in water solution. 2-Bromo-4-methyl-5-nitroaniline can be used as a catalyst to produce target products in an industrialized environment.
!-- END -->

Formula: C₇H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 231.05 g/mol

Ref: 3D-CEA16999