CymitQuimica logo

CAS 102169-99-3

:

2-Bromo-4-methyl-5-nitrobenzenamine

Description:
2-Bromo-4-methyl-5-nitrobenzenamine, with the CAS number 102169-99-3, is an organic compound that belongs to the class of aromatic amines. It features a bromine atom, a methyl group, and a nitro group attached to a benzene ring, which contributes to its unique chemical properties. The presence of the amino group (-NH2) makes it a primary amine, allowing for potential reactivity in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The nitro group (-NO2) is a strong electron-withdrawing group, which can influence the compound's reactivity and stability. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents. Its bromine substituent can also impart specific reactivity, making it useful in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as many aromatic amines can be hazardous and potentially carcinogenic. Overall, 2-Bromo-4-methyl-5-nitrobenzenamine is of interest in various fields, including pharmaceuticals and materials science.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c1-4-2-5(8)6(9)3-7(4)10(11)12/h2-3H,9H2,1H3
InChI key:InChIKey=MZYLMACPWDPBQN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C=C(Br)C(N)=C1
Synonyms:
  • 2-Bromo-4-methyl-5-nitrobenzenamine
  • Benzenamine, 2-bromo-4-methyl-5-nitro-
  • 2-Bromo-4-methyl-5-nitroaniline
  • p-Toluidine, 2-bromo-5-nitro-
Found 5 products.