CAS 102170-24-1
:1-Methoxypiperidin-4-one
Description:
1-Methoxypiperidin-4-one, with the CAS number 102170-24-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methoxy group (-OCH3) at the 1-position and a ketone functional group (C=O) at the 4-position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. The methoxy group can influence the compound's electronic properties, potentially affecting its biological activity. Additionally, the piperidine moiety is often associated with various pharmacological effects, making 1-Methoxypiperidin-4-one of interest in drug discovery and development. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-9-7-4-2-6(8)3-5-7/h2-5H2,1H3
InChI key:InChIKey=GWMISASZFLPFMP-UHFFFAOYSA-N
SMILES:O(C)N1CCC(=O)CC1
Synonyms:- 1-Methoxy-4-piperidinone
- 4-Piperidinone, 1-methoxy-
- 4-Piperidone, 1-methoxy-
- N-Methoxypiperidin-4-one
- 1-Methoxypiperidin-4-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-methoxypiperidin-4-one
CAS:Formula:C6H11NO2Purity:95%Color and Shape:LiquidMolecular weight:129.15701-Methoxypiperidin-4-one
CAS:1-Methoxypiperidin-4-oneFormula:C6H11NO2Purity:95%Molecular weight:129.161-Methoxypiperidin-4-one
CAS:1-Methoxypiperidin-4-oneFormula:C6H11NO2Purity:95%Molecular weight:129.161-Methoxypiperidin-4-one
CAS:1-Methoxypiperidin-4-one is a dione that is used as a fungicide. It inhibits the development of resistance in organisms and can be used to control diseases caused by fungi. 1-Methoxypiperidin-4-one has been shown to be effective against crop plants, such as cucumbers and melons, but not against pollinators such as bees. It is also effective against organisms that are resistant to other fungicides, such as neonicotinoids. This compound is produced through a phenylalanine pathway and has a fatty acid profile that consists mainly of unsaturated fatty acids with an odd number of carbon atoms.Formula:C6H11NO2Purity:Min. 95%Molecular weight:129.15 g/mol



