CymitQuimica logo

CAS 102186-93-6

:

N-(2-fluorophenyl)-1H-imidazole-5-carboxamide

Description:
N-(2-fluorophenyl)-1H-imidazole-5-carboxamide, with the CAS number 102186-93-6, is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a carboxamide functional group enhances its solubility and potential reactivity, while the 2-fluorophenyl substituent introduces unique electronic and steric properties that can influence its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its structural features may contribute to specific binding affinities and mechanisms of action, making it a candidate for further research in drug discovery. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts. Overall, N-(2-fluorophenyl)-1H-imidazole-5-carboxamide represents a significant interest in the field of organic and medicinal chemistry.
Formula:C10H8FN3O
InChI:InChI=1S/C10H8FN3O/c11-7-3-1-2-4-8(7)14-10(15)9-5-12-6-13-9/h1-6H,(H,12,13)(H,14,15)
InChI key:DPYAJCSMMZRZDO-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)NC(=O)C2=CN=CN2)F
Found 2 products.