CymitQuimica logo

CAS 1021919-65-2

:

3H-IMidazo[4,5-b]pyridine-3-carboxylic acid, 6-broMo-1,2-dihydro-2-oxo-, 1,1-diMethylethyl ester

Description:
3H-Imidazo[4,5-b]pyridine-3-carboxylic acid, 6-bromo-1,2-dihydro-2-oxo-, 1,1-dimethylethyl ester is a chemical compound characterized by its imidazo-pyridine core structure, which is known for its biological activity and potential pharmaceutical applications. The presence of a carboxylic acid moiety indicates that it can participate in various chemical reactions, such as esterification and amidation. The bromine substituent at the 6-position can influence the compound's reactivity and biological properties, potentially enhancing its interaction with biological targets. The dimethyl ether group suggests increased lipophilicity, which may improve the compound's membrane permeability and bioavailability. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, common among imidazo-pyridine derivatives. Its specific applications and efficacy would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H12BrN3O3
InChI:InChI=1S/C11H12BrN3O3/c1-11(2,3)18-10(17)15-8-7(14-9(15)16)4-6(12)5-13-8/h4-5H,1-3H3,(H,14,16)
InChI key:SBWRCBWUEGILPU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C2=C(C=C(C=N2)Br)NC1=O
Found 4 products.