CAS 102199-53-1
:2-Pentenedioic acid, 2-[2-[[(phenylmethoxy)carbonyl]amino]-4-thiazolyl]-
Description:
2-Pentenedioic acid, 2-[2-[[(phenylmethoxy)carbonyl]amino]-4-thiazolyl]- is a complex organic compound characterized by its dual functional groups, which include a pentenedioic acid moiety and a thiazole ring substituted with a phenylmethoxycarbonylamino group. This structure suggests that the compound may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The presence of the thiazole ring indicates potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The phenylmethoxy group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the compound's molecular structure suggests it may engage in hydrogen bonding due to the carboxylic acid and amine functionalities, which could affect its reactivity and interaction with other molecules. Overall, this compound's unique characteristics make it of interest in both synthetic organic chemistry and potential medicinal applications.
Formula:C16H14N2O6S
InChI:InChI=1S/C16H14N2O6S/c19-13(20)7-6-11(14(21)22)12-9-25-15(17-12)18-16(23)24-8-10-4-2-1-3-5-10/h1-6,9H,7-8H2,(H,19,20)(H,21,22)(H,17,18,23)
InChI key:KCJOTWMQVWNZSP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)NC2=NC(=CS2)C(=CCC(=O)O)C(=O)O
Synonyms:- 2-(2-(((benzyloxy)carbonyl)amino)thiazol-4-yl)pent-2-enedioic acid
- Ceftibuten Impurity 11
- Ceftibuten Related Impurity 1
- 2-Pentenedioic acid, 2-[2-[[(phenylmethoxy)carbonyl]amino]-4-thiazolyl]-
- Ceftibuten Impurity 1
- 2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enedioic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Pentenedioic acid, 2-[2-[[(phenylmethoxy)carbonyl]amino]-4-thiazolyl]-
CAS:Formula:C16H14N2O6SMolecular weight:362.3572

