CAS 1022-45-3
:2-PHENYL-4-[3H]QUINAZOLINONE
Description:
2-Phenyl-4-[3H]quinazolinone, with the CAS number 1022-45-3, is a heterocyclic organic compound characterized by its quinazolinone structure, which consists of a fused benzene and pyrimidine ring system. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. The presence of the phenyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological targets. The compound's molecular structure allows for various chemical modifications, which can lead to derivatives with improved efficacy or selectivity. Additionally, 2-phenyl-4-[3H]quinazolinone may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, due to the reactivity of its functional groups. Its solubility can vary depending on the solvent, and it is generally stable under standard laboratory conditions. Overall, this compound serves as a valuable scaffold in medicinal chemistry and drug development.
Formula:C14H10N2O
InChI:InChI=1/C14H10N2O/c17-14-11-8-4-5-9-12(11)15-13(16-14)10-6-2-1-3-7-10/h1-9H,(H,15,16,17)
InChI key:VDULOAUXSMYUMG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1nc2ccccc2c(n1)O
Synonyms:- 4(1H)-Quinazolinone, 2-Phenyl-
- 2-Phenyl-4(1H)-Quinazolinone
- 2-phenylquinazolin-4(1H)-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Phenylquinazolin-4-ol
CAS:2-Phenylquinazolin-4-olFormula:C14H10N2OPurity:98%Molecular weight:222.252-Phenylquinazolin-4-ol
CAS:Formula:C14H10N2OPurity:97%Color and Shape:SolidMolecular weight:222.24202-Phenylquinazolin-4-ol
CAS:2-Phenylquinazolin-4-olFormula:C14H10N2OPurity:97%Molecular weight:222.242-Phenylquinazolin-4(3h)-one
CAS:Controlled ProductApplications 2-PHENYLQUINAZOLIN-4(3H)-ONE (cas# 1022-45-3) is a useful research chemical.
Formula:C14H10N2OColor and Shape:NeatMolecular weight:222.242-Phenyl-4(3H)-quinazolinone
CAS:2-Phenyl-4(3H)-quinazolinone (2-PKQ) is a novel chemical compound that has been shown to have apoptotic properties. It induces cell death by inducing apoptosis, and it blocks the antiplatelet effects of adriamycin. 2-PKQ also has significant inhibitory activities against cancer cells, and it inhibits the growth of B16 melanoma cells in vitro with an IC50 of 0.004 μM. 2-PKQ has been shown to be effective in inhibiting platelet aggregation in a dose dependent manner, suggesting that it may be useful for treating patients with thrombocytopenia or thrombocytopathy associated with leukemia or other blood diseases. 2-PKQ has been found to be fluorescent, which can be used for its detection and quantification.Formula:C14H10N2OPurity:Min. 95%Molecular weight:222.24 g/mol





