CymitQuimica logo

CAS 102207-05-6

:

1-(1-Phenylcycloheptyl)piperidine hydrobromide

Description:
1-(1-Phenylcycloheptyl)piperidine hydrobromide is a chemical compound characterized by its unique structure, which includes a piperidine ring and a phenylcycloheptyl moiety. This compound is typically classified as a piperidine derivative and is known for its potential pharmacological properties. It is often studied in the context of neuroscience and medicinal chemistry due to its interactions with various neurotransmitter systems. The hydrobromide salt form indicates that it is a hydrochloride salt, which can enhance its solubility in water and facilitate its use in biological studies. The compound's molecular structure contributes to its lipophilicity, which may influence its ability to cross biological membranes. As with many piperidine derivatives, it may exhibit a range of biological activities, including analgesic or psychoactive effects, making it of interest in drug development. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C18H28BrN
InChI:InChI=1/C18H27N.BrH/c1-2-8-14-18(13-7-1,17-11-5-3-6-12-17)19-15-9-4-10-16-19;/h3,5-6,11-12H,1-2,4,7-10,13-16H2;1H
InChI key:ZWHIYZZOMZCVTG-UHFFFAOYSA-N
SMILES:C1CCCC(CC1)(c1ccccc1)N1CCCCC1.Br
Synonyms:
  • Piperidine, 1-(1-phenyl-1-cycloheptyl)-, hydrobromide
Found 1 products.