CAS 102209-75-6
:C6-(N1-methyl-1,2,3-trazolylmethylene)penem
Description:
C6-(N1-methyl-1,2,3-trazolylmethylene)penem, with the CAS number 102209-75-6, is a synthetic compound belonging to the penem class of antibiotics, which are characterized by their beta-lactam structure. This compound features a unique substitution at the C6 position, where a 1,2,3-triazole moiety is incorporated, enhancing its antibacterial properties. The presence of the methyl group on the triazole ring contributes to its lipophilicity, potentially improving membrane permeability and bioavailability. Penems are known for their broad-spectrum activity against various Gram-positive and Gram-negative bacteria, making them valuable in treating infections. The specific structural modifications in C6-(N1-methyl-1,2,3-trazolylmethylene)penem may also influence its resistance to beta-lactamases, enzymes produced by some bacteria that confer resistance to beta-lactam antibiotics. Overall, this compound represents a significant area of research in antibiotic development, aiming to combat antibiotic resistance and improve therapeutic efficacy.
Formula:C10H9N4NaO3S
InChI:InChI=1/C10H10N4O3S.Na/c1-13-3-5(11-12-13)2-6-8(15)14-7(10(16)17)4-18-9(6)14;/h2-3,7,9H,4H2,1H3,(H,16,17);/q;+1/p-1/b6-2-;
SMILES:Cn1cc(C=C2C(=O)N3C(CSC23)C(=O)O)nn1.[Na]
Synonyms:- Brl 42715
- 4-Thia-1-azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, 6-((1-methyl-1H-1,2,3-triazol-4-yl)methylene)-7-oxo-, sodium salt, (R-(Z))-
- sodium (5R,6E)-6-[(1-methyl-1H-1,2,3-triazol-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate
- sodium (6Z)-6-[(1-methyl-1H-1,2,3-triazol-4-yl)methylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
- C6-(N1-Methyl-1,2,3-trazolylmethylene)penem
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
BRL 42715
CAS:BRL 42715 is an antibacterial agent, which is a synthetic compound with a unique mechanism of action. This compound is derived from rational drug design aimed at targeting specific bacterial enzymes critical for cell wall synthesis. By irreversibly inhibiting these enzymes, BRL 42715 disrupts the bacterial cell wall formation, leading to cell lysis and death.Formula:C10H7N4NaO3SPurity:Min. 95%Molecular weight:286.24 g/molBRL-42715
CAS:BRL-42715 is an effective inhibitor of bacterial beta-lactamases.Formula:C10H7N4NaO3SPurity:98%Color and Shape:SolidMolecular weight:286.24


