CymitQuimica logo

CAS 1022091-49-1

:

5,7-Difluoro-6-bromoquinoline

Description:
5,7-Difluoro-6-bromoquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of two fluorine atoms at the 5 and 7 positions and a bromine atom at the 6 position contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can influence biological activity. Additionally, the fluorine atoms can enhance metabolic stability and alter the compound's interaction with biological targets. As with many halogenated compounds, 5,7-Difluoro-6-bromoquinoline may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C9H4BrF2N
InChI:InChI=1S/C9H4BrF2N/c10-8-6(11)4-7-5(9(8)12)2-1-3-13-7/h1-4H
InChI key:DUAWZZRBLJDTQC-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C(C=C2N=C1)F)Br)F
Synonyms:
  • 6-Bromo-5,7-Difluoroquinoline
Found 4 products.