CymitQuimica logo

CAS 1022159-15-4

:

tert-Butyl (1r,4r)-4-aminocyclohexane-1-carboxylate

Description:
Tert-Butyl (1R,4R)-4-aminocyclohexane-1-carboxylate is an organic compound characterized by its cyclohexane structure, which features a carboxylate group and an amino group. The presence of the tert-butyl group enhances its solubility in organic solvents and contributes to its steric bulk, influencing its reactivity and interaction with other molecules. The compound exhibits chirality due to the specific stereochemistry at the cyclohexane ring, which can affect its biological activity and pharmacological properties. It is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's stability, solubility, and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions during handling and experimentation. Safety data sheets should be consulted for proper handling and potential hazards associated with this substance. Overall, tert-Butyl (1R,4R)-4-aminocyclohexane-1-carboxylate is a valuable compound in synthetic organic chemistry with specific applications in various fields.
Formula:C11H21NO2
InChI:InChI=1S/C11H21NO2/c1-11(2,3)14-10(13)8-4-6-9(12)7-5-8/h8-9H,4-7,12H2,1-3H3
InChI key:XDTZRQLZSNTGSM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1CCC(CC1)N
Found 5 products.