CymitQuimica logo

CAS 102227-52-1

:

3-(pyridin-4-yl)-1,2,4-oxadiazol-5(2H)-one

Description:
3-(Pyridin-4-yl)-1,2,4-oxadiazol-5(2H)-one, with the CAS number 102227-52-1, is a heterocyclic compound characterized by the presence of both a pyridine ring and an oxadiazole moiety. This compound typically exhibits a crystalline solid form and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. The oxadiazole ring contributes to its stability and reactivity, making it a subject of interest in medicinal chemistry. The pyridine component enhances its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the compound's structure allows for various substitution patterns, which can be explored to optimize its pharmacological properties. Its synthesis often involves cyclization reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its molecular structure and purity. Overall, this compound represents a valuable scaffold for the development of new therapeutic agents.
Formula:C7H5N3O2
InChI:InChI=1/C7H5N3O2/c11-7-9-6(10-12-7)5-1-3-8-4-2-5/h1-4H,(H,9,10,11)
InChI key:RDGQKNGDCGSGCR-UHFFFAOYSA-N
SMILES:c1cnccc1c1nc(=O)o[nH]1
Synonyms:
  • 1,2,4-Oxadiazol-5(2H)-one, 3-(4-pyridinyl)-
  • 1,2,4-Oxadiazol-5-Ol, 3-(4-Pyridinyl)-
  • 3-(Pyridin-4-Yl)-1,2,4-Oxadiazol-5-Ol
Found 2 products.