CAS 102236-24-8
:Benzene, 4-chloro-1-ethoxy-2-nitro-
Description:
Benzene, 4-chloro-1-ethoxy-2-nitro- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group, an ethoxy group, and a nitro group. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The ethoxy group contributes to the compound's solubility in organic solvents and can affect its boiling and melting points. The nitro group is known for its electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic substitution reactions. This compound may exhibit various physical properties such as color, odor, and state at room temperature, which are typical of substituted aromatic compounds. Additionally, due to the presence of the nitro group, it may have applications in organic synthesis and as an intermediate in the production of other chemical compounds. Safety and handling precautions are essential, as nitro compounds can be hazardous. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential applications in various fields.
Formula:C8H8ClNO3
InChI:InChI=1S/C8H8ClNO3/c1-2-13-8-4-3-6(9)5-7(8)10(11)12/h3-5H,2H2,1H3
InChI key:SKMDJPLCXWZTCN-UHFFFAOYSA-N
SMILES:CCOC1=C(C=C(C=C1)Cl)[N+](=O)[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

