CymitQuimica logo

CAS 102253-71-4

:

Pyridine, 4-(1,2,3-thiadiazol-4-yl)-

Description:
Pyridine, 4-(1,2,3-thiadiazol-4-yl)-, with the CAS number 102253-71-4, is a heterocyclic organic compound that features a pyridine ring substituted with a 1,2,3-thiadiazole moiety. This compound exhibits characteristics typical of both pyridine and thiadiazole derivatives, including potential aromaticity and basicity due to the nitrogen atoms present in the rings. Pyridine itself is known for its distinctive odor and is a polar solvent, while the thiadiazole group can impart unique chemical reactivity and biological activity. The presence of the thiadiazole ring may enhance the compound's properties, making it of interest in medicinal chemistry and material science. Additionally, this compound may exhibit various biological activities, including antimicrobial or antifungal properties, depending on its specific structure and substituents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, pyridine, 4-(1,2,3-thiadiazol-4-yl)- is a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C7H5N3S
InChI:InChI=1S/C7H5N3S/c1-3-8-4-2-6(1)7-5-11-10-9-7/h1-5H
InChI key:CBBNSZNUEUONCU-UHFFFAOYSA-N
SMILES:C1=CN=CC=C1C2=CSN=N2
Found 2 products.