CymitQuimica logo

CAS 10227-64-2

:

Ethanone, 1-(1H-benzimidazol-2-yl)-2-chloro- (9CI)

Description:
Ethanone, 1-(1H-benzimidazol-2-yl)-2-chloro- (CAS 10227-64-2) is an organic compound characterized by its structure, which features a benzimidazole moiety and a chloro substituent on the ethanone framework. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. The presence of the benzimidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The chloro group can influence the compound's reactivity and interaction with biological targets. Ethanone derivatives often display a range of properties, including antimicrobial and antifungal activities, which can be attributed to their ability to interact with various cellular mechanisms. Additionally, the compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature. As with many chemical substances, safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H7ClN2O
InChI:InChI=1/C9H7ClN2O/c10-5-8(13)9-11-6-3-1-2-4-7(6)12-9/h1-4H,5H2,(H,11,12)
InChI key:WUDLRXMKBSHPAJ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)[nH]c(C(=O)CCl)n2
Found 2 products.