CymitQuimica logo

CAS 10228-99-6

:

Pentanoic acid, 4,4-dimethyl-, ethyl ester

Description:
Pentanoic acid, 4,4-dimethyl-, ethyl ester, also known as ethyl 4,4-dimethylpentanoate, is an organic compound characterized by its ester functional group derived from pentanoic acid and ethanol. It features a five-carbon chain with two methyl groups attached to the fourth carbon, contributing to its branched structure. This compound is typically a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavoring and fragrance applications. Its molecular structure imparts moderate polarity, influencing its solubility in organic solvents while being less soluble in water. Pentanoic acid derivatives often exhibit low toxicity, but safety precautions should be taken during handling. The compound's boiling point and melting point are influenced by its molecular weight and branching, which can affect its volatility and stability. Additionally, it may participate in various chemical reactions typical of esters, such as hydrolysis and transesterification, making it relevant in synthetic organic chemistry. Overall, its unique structure and properties make it of interest in both industrial and research contexts.
Formula:C9H18O2
InChI:InChI=1S/C9H18O2/c1-5-11-8(10)6-7-9(2,3)4/h5-7H2,1-4H3
InChI key:PUJGGPCGKBGBAD-UHFFFAOYSA-N
SMILES:CCOC(=O)CCC(C)(C)C
Found 2 products.