CymitQuimica logo

CAS 102284-41-3

:

1-Pyrrolidinecarboxylic acid, 2-(chloroacetyl)-, 1,1-dimethylethyl ester,(2S)-

Description:
1-Pyrrolidinecarboxylic acid, 2-(chloroacetyl)-, 1,1-dimethylethyl ester, with the CAS number 102284-41-3, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a chloroacetyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl ester group enhances its lipophilicity, which can influence its solubility and permeability in biological systems. As a chiral molecule, it exists in specific stereoisomeric forms, with the (2S) configuration indicating the spatial arrangement of its substituents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and reactivity can be influenced by the functional groups present, allowing for various modifications and applications in medicinal chemistry. Safety and handling precautions should be observed due to the presence of the chloroacetyl moiety, which can be reactive and potentially hazardous.
Formula:C11H18ClNO3
InChI:InChI=1S/C11H18ClNO3/c1-11(2,3)16-10(15)13-6-4-5-8(13)9(14)7-12/h8H,4-7H2,1-3H3/t8-/m0/s1
InChI key:FXJFCSOQVPPIHK-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)CCl
Found 1 products.