CymitQuimica logo

CAS 102292-30-8

:

5-bromo-2-methyl-2,3-dihydro-1-benzofuran

Description:
5-Bromo-2-methyl-2,3-dihydro-1-benzofuran is an organic compound characterized by its unique bicyclic structure, which combines a benzofuran moiety with a bromine substituent and a methyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. The dihydrobenzofuran structure contributes to its stability and solubility in organic solvents, while the methyl group can influence its steric and electronic properties. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular formula and specific functional groups can also dictate its interactions with other chemical species, influencing its applications in synthetic organic chemistry. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with bromine-containing substances. Overall, 5-bromo-2-methyl-2,3-dihydro-1-benzofuran represents a versatile compound with significant implications in both research and industrial applications.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-3,5-6H,4H2,1H3
InChI key:FEPPMMHYULGHKP-UHFFFAOYSA-N
SMILES:CC1Cc2cc(ccc2O1)Br
Synonyms:
  • Benzofuran, 5-Bromo-2,3-Dihydro-2-Methyl-
Found 3 products.