CymitQuimica logo

CAS 1022922-17-3

:

B-(5-Acetyl-2-chlorophenyl)boronic acid

Description:
B-(5-Acetyl-2-chlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both an acetyl group and a chlorine atom. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the acetyl group can influence its reactivity and solubility, while the chlorine atom may affect its electronic properties and interactions with biological targets. B-(5-Acetyl-2-chlorophenyl)boronic acid is often utilized in cross-coupling reactions, particularly in the synthesis of complex organic molecules. Additionally, its structural features may impart specific biological activities, making it a candidate for further investigation in drug development. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions to maintain stability.
Formula:C8H8BClO3
InChI:InChI=1S/C8H8BClO3/c1-5(11)6-2-3-8(10)7(4-6)9(12)13/h2-4,12-13H,1H3
InChI key:InChIKey=QMHQVMHOGNFKMA-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C(C)=O)=CC=C1Cl
Synonyms:
  • (5-Acetyl-2-chlorophenyl)boronic acid
  • 5-Acetyl-2-chlorophenylboronic acid
  • B-(5-Acetyl-2-chlorophenyl)boronic acid
  • [2-Chloro-5-acetylphenyl]boronic acid
  • Boronic acid, B-(5-acetyl-2-chlorophenyl)-
Found 5 products.