CymitQuimica logo

CAS 102297-62-1

:

Benzoic acid, 4-acetyl-3-hydroxy-

Description:
Benzoic acid, 4-acetyl-3-hydroxy- (CAS 102297-62-1) is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety with additional functional groups. It features a hydroxyl group (-OH) and an acetyl group (-COCH3) attached to the benzene ring, specifically at the 3 and 4 positions, respectively. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water may vary depending on pH. The presence of the hydroxyl group contributes to its potential as a weak acid, while the acetyl group can influence its reactivity and interactions with other molecules. Benzoic acid derivatives are known for their applications in various fields, including pharmaceuticals, food preservation, and as intermediates in organic synthesis. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions in laboratory settings.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c1-5(10)7-3-2-6(9(12)13)4-8(7)11/h2-4,11H,1H3,(H,12,13)
InChI key:MKTAASUBWXZBNB-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=C(C=C1)C(=O)O)O
Found 5 products.